C24H36BrNO3Si — CID 68921984
methyl 2-bromo-1-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-3-cyclohexylindole-6-carboxylate (PubChem CID 68921984) has the molecular formula C24H36BrNO3Si and a molecular weight of 494.55 g/mol. Its IUPAC name is methyl 2-bromo-1-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-3-cyclohexylindole-6-carboxylate.
| Compound Name | methyl 2-bromo-1-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-3-cyclohexylindole-6-carboxylate |
|---|---|
| PubChem CID | 68921984 |
| Molecular Formula | C24H36BrNO3Si |
| Molecular Weight | 494.55 g/mol |
| Exact Mass | 493.16 |
| IUPAC Name | methyl 2-bromo-1-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-3-cyclohexylindole-6-carboxylate |
| SMILES | COC(=O)c1ccc2c(C3CCCCC3)c(Br)n(CCO[Si](C)(C)C(C)(C)C)c2c1 |
| InChI | InChI=1S/C24H36BrNO3Si/c1-24(2,3)30(5,6)29-15-14-26-20-16-18(23(27)28-4)12-13-19(20)21(22(26)25)17-10-8-7-9-11-17/h12-13,16-17H,7-11,14-15H2,1-6H3 |
| InChIKey | UMSJSXWVHCXOHD-UHFFFAOYSA-N |
| XLogP | 7.26 |
| TPSA | 40.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.55 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|