C19H21BrN2O2 — CID 58765170
methyl 2-bromo-1-(2-cyanoethyl)-3-cyclohexylindole-6-carboxylate (PubChem CID 58765170) has the molecular formula C19H21BrN2O2 and a molecular weight of 389.29 g/mol. Its IUPAC name is methyl 2-bromo-1-(2-cyanoethyl)-3-cyclohexylindole-6-carboxylate.
| Compound Name | methyl 2-bromo-1-(2-cyanoethyl)-3-cyclohexylindole-6-carboxylate |
|---|---|
| PubChem CID | 58765170 |
| Molecular Formula | C19H21BrN2O2 |
| Molecular Weight | 389.29 g/mol |
| Exact Mass | 388.08 |
| IUPAC Name | methyl 2-bromo-1-(2-cyanoethyl)-3-cyclohexylindole-6-carboxylate |
| SMILES | COC(=O)c1ccc2c(C3CCCCC3)c(Br)n(CCC#N)c2c1 |
| InChI | InChI=1S/C19H21BrN2O2/c1-24-19(23)14-8-9-15-16(12-14)22(11-5-10-21)18(20)17(15)13-6-3-2-4-7-13/h8-9,12-13H,2-7,11H2,1H3 |
| InChIKey | LSYAERUSABIPHC-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 55.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.29 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |