C20H26BrNO2 — CID 123693531
2-bromoprop-1-ene;methyl 3-cyclopentyl-1,2-dimethylindole-6-carboxylate (PubChem CID 123693531) has the molecular formula C20H26BrNO2 and a molecular weight of 392.34 g/mol. Its IUPAC name is 2-bromoprop-1-ene;methyl 3-cyclopentyl-1,2-dimethylindole-6-carboxylate.
| Compound Name | 2-bromoprop-1-ene;methyl 3-cyclopentyl-1,2-dimethylindole-6-carboxylate |
|---|---|
| PubChem CID | 123693531 |
| Molecular Formula | C20H26BrNO2 |
| Molecular Weight | 392.34 g/mol |
| Exact Mass | 391.11 |
| IUPAC Name | 2-bromoprop-1-ene;methyl 3-cyclopentyl-1,2-dimethylindole-6-carboxylate |
| SMILES | C=C(C)Br.COC(=O)c1ccc2c(C3CCCC3)c(C)n(C)c2c1 |
| InChI | InChI=1S/C17H21NO2.C3H5Br/c1-11-16(12-6-4-5-7-12)14-9-8-13(17(19)20-3)10-15(14)18(11)2;1-3(2)4/h8-10,12H,4-7H2,1-3H3;1H2,2H3 |
| InChIKey | WAOPFROEYXJETK-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 31.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.34 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|