C27H30N2O4 — CID 58676999
methyl 2-(2-aminophenyl)-3-cyclohexyl-1-(3-ethoxy-3-oxoprop-1-en-2-yl)indole-6-carboxylate (PubChem CID 58676999) has the molecular formula C27H30N2O4 and a molecular weight of 446.55 g/mol. Its IUPAC name is methyl 2-(2-aminophenyl)-3-cyclohexyl-1-(3-ethoxy-3-oxoprop-1-en-2-yl)indole-6-carboxylate.
| Compound Name | methyl 2-(2-aminophenyl)-3-cyclohexyl-1-(3-ethoxy-3-oxoprop-1-en-2-yl)indole-6-carboxylate |
|---|---|
| PubChem CID | 58676999 |
| Molecular Formula | C27H30N2O4 |
| Molecular Weight | 446.55 g/mol |
| Exact Mass | 446.22 |
| IUPAC Name | methyl 2-(2-aminophenyl)-3-cyclohexyl-1-(3-ethoxy-3-oxoprop-1-en-2-yl)indole-6-carboxylate |
| SMILES | C=C(C(=O)OCC)n1c(-c2ccccc2N)c(C2CCCCC2)c2ccc(C(=O)OC)cc21 |
| InChI | InChI=1S/C27H30N2O4/c1-4-33-26(30)17(2)29-23-16-19(27(31)32-3)14-15-21(23)24(18-10-6-5-7-11-18)25(29)20-12-8-9-13-22(20)28/h8-9,12-16,18H,2,4-7,10-11,28H2,1,3H3 |
| InChIKey | WPBKLZVLNCQIPW-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.55 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|