C30H35NO5 — CID 89337446
methyl 1-(3-butoxy-3-oxoprop-1-en-2-yl)-3-cyclohexyl-2-[2-(hydroxymethyl)phenyl]indole-6-carboxylate (PubChem CID 89337446) has the molecular formula C30H35NO5 and a molecular weight of 489.61 g/mol. Its IUPAC name is methyl 1-(3-butoxy-3-oxoprop-1-en-2-yl)-3-cyclohexyl-2-[2-(hydroxymethyl)phenyl]indole-6-carboxylate.
| Compound Name | methyl 1-(3-butoxy-3-oxoprop-1-en-2-yl)-3-cyclohexyl-2-[2-(hydroxymethyl)phenyl]indole-6-carboxylate |
|---|---|
| PubChem CID | 89337446 |
| Molecular Formula | C30H35NO5 |
| Molecular Weight | 489.61 g/mol |
| Exact Mass | 489.25 |
| IUPAC Name | methyl 1-(3-butoxy-3-oxoprop-1-en-2-yl)-3-cyclohexyl-2-[2-(hydroxymethyl)phenyl]indole-6-carboxylate |
| SMILES | C=C(C(=O)OCCCC)n1c(-c2ccccc2CO)c(C2CCCCC2)c2ccc(C(=O)OC)cc21 |
| InChI | InChI=1S/C30H35NO5/c1-4-5-17-36-29(33)20(2)31-26-18-22(30(34)35-3)15-16-25(26)27(21-11-7-6-8-12-21)28(31)24-14-10-9-13-23(24)19-32/h9-10,13-16,18,21,32H,2,4-8,11-12,17,19H2,1,3H3 |
| InChIKey | YBWDTOKZNJEJRA-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.61 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|