C29H47NO2Sn — CID 66969307
methyl 3-cyclohexyl-2-methyl-1-tributylstannylindole-6-carboxylate (PubChem CID 66969307) has the molecular formula C29H47NO2Sn and a molecular weight of 560.41 g/mol. Its IUPAC name is methyl 3-cyclohexyl-2-methyl-1-tributylstannylindole-6-carboxylate.
| Compound Name | methyl 3-cyclohexyl-2-methyl-1-tributylstannylindole-6-carboxylate |
|---|---|
| PubChem CID | 66969307 |
| Molecular Formula | C29H47NO2Sn |
| Molecular Weight | 560.41 g/mol |
| Exact Mass | 561.26 |
| IUPAC Name | methyl 3-cyclohexyl-2-methyl-1-tributylstannylindole-6-carboxylate |
| SMILES | CCCC[Sn](CCCC)(CCCC)n1c(C)c(C2CCCCC2)c2ccc(C(=O)OC)cc21 |
| InChI | InChI=1S/C17H21NO2.3C4H9.Sn/c1-11-16(12-6-4-3-5-7-12)14-9-8-13(17(19)20-2)10-15(14)18-11;3*1-3-4-2;/h8-10,12H,3-7H2,1-2H3,(H,18,19);3*1,3-4H2,2H3;/q;;;;+1/p-1 |
| InChIKey | RFEVFAKLQSTMQU-UHFFFAOYSA-M |
| XLogP | 8.98 |
| TPSA | 31.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.41 |
| LogP ≤ 5 | 8.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |