C22H25NO3 — CID 58866261
methyl 3-cyclohexyl-1-ethyl-2-(furan-3-yl)indole-6-carboxylate (PubChem CID 58866261) has the molecular formula C22H25NO3 and a molecular weight of 351.45 g/mol. Its IUPAC name is methyl 3-cyclohexyl-1-ethyl-2-(furan-3-yl)indole-6-carboxylate.
| Compound Name | methyl 3-cyclohexyl-1-ethyl-2-(furan-3-yl)indole-6-carboxylate |
|---|---|
| PubChem CID | 58866261 |
| Molecular Formula | C22H25NO3 |
| Molecular Weight | 351.45 g/mol |
| Exact Mass | 351.18 |
| IUPAC Name | methyl 3-cyclohexyl-1-ethyl-2-(furan-3-yl)indole-6-carboxylate |
| SMILES | CCn1c(-c2ccoc2)c(C2CCCCC2)c2ccc(C(=O)OC)cc21 |
| InChI | InChI=1S/C22H25NO3/c1-3-23-19-13-16(22(24)25-2)9-10-18(19)20(15-7-5-4-6-8-15)21(23)17-11-12-26-14-17/h9-15H,3-8H2,1-2H3 |
| InChIKey | IBUXVIRFYBTFKF-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 44.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.45 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |