C26H34N4O4S — CID 143824862
1-[2-[4-[aminosulfanyl(methyl)amino]butylamino]-2-oxoethyl]-3-cyclohexyl-2-(furan-3-yl)indole-6-carboxylic acid (PubChem CID 143824862) has the molecular formula C26H34N4O4S and a molecular weight of 498.65 g/mol. Its IUPAC name is 1-[2-[4-[aminosulfanyl(methyl)amino]butylamino]-2-oxoethyl]-3-cyclohexyl-2-(furan-3-yl)indole-6-carboxylic acid.
| Compound Name | 1-[2-[4-[aminosulfanyl(methyl)amino]butylamino]-2-oxoethyl]-3-cyclohexyl-2-(furan-3-yl)indole-6-carboxylic acid |
|---|---|
| PubChem CID | 143824862 |
| Molecular Formula | C26H34N4O4S |
| Molecular Weight | 498.65 g/mol |
| Exact Mass | 498.23 |
| IUPAC Name | 1-[2-[4-[aminosulfanyl(methyl)amino]butylamino]-2-oxoethyl]-3-cyclohexyl-2-(furan-3-yl)indole-6-carboxylic acid |
| SMILES | CN(CCCCNC(=O)Cn1c(-c2ccoc2)c(C2CCCCC2)c2ccc(C(=O)O)cc21)SN |
| InChI | InChI=1S/C26H34N4O4S/c1-29(35-27)13-6-5-12-28-23(31)16-30-22-15-19(26(32)33)9-10-21(22)24(18-7-3-2-4-8-18)25(30)20-11-14-34-17-20/h9-11,14-15,17-18H,2-8,12-13,16,27H2,1H3,(H,28,31)(H,32,33) |
| InChIKey | VEFJDDLVJDBBJM-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 113.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.65 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|