C30H40N4O6S — CID 59549051
methyl 3-cyclohexyl-2-(4-methoxyphenyl)-1-[2-[4-[methyl(sulfamoyl)amino]butylamino]-2-oxoethyl]indole-6-carboxylate (PubChem CID 59549051) has the molecular formula C30H40N4O6S and a molecular weight of 584.74 g/mol. Its IUPAC name is methyl 3-cyclohexyl-2-(4-methoxyphenyl)-1-[2-[4-[methyl(sulfamoyl)amino]butylamino]-2-oxoethyl]indole-6-carboxylate.
| Compound Name | methyl 3-cyclohexyl-2-(4-methoxyphenyl)-1-[2-[4-[methyl(sulfamoyl)amino]butylamino]-2-oxoethyl]indole-6-carboxylate |
|---|---|
| PubChem CID | 59549051 |
| Molecular Formula | C30H40N4O6S |
| Molecular Weight | 584.74 g/mol |
| Exact Mass | 584.27 |
| IUPAC Name | methyl 3-cyclohexyl-2-(4-methoxyphenyl)-1-[2-[4-[methyl(sulfamoyl)amino]butylamino]-2-oxoethyl]indole-6-carboxylate |
| SMILES | COC(=O)c1ccc2c(C3CCCCC3)c(-c3ccc(OC)cc3)n(CC(=O)NCCCCN(C)S(N)(=O)=O)c2c1 |
| InChI | InChI=1S/C30H40N4O6S/c1-33(41(31,37)38)18-8-7-17-32-27(35)20-34-26-19-23(30(36)40-3)13-16-25(26)28(21-9-5-4-6-10-21)29(34)22-11-14-24(39-2)15-12-22/h11-16,19,21H,4-10,17-18,20H2,1-3H3,(H,32,35)(H2,31,37,38) |
| InChIKey | UWUQKQQZIHCCOM-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 132.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.74 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|