C30H40N4O6S — CID 67236217
3-cyclohexyl-1-methyl-2-[2-[2-[5-[methyl(sulfamoyl)amino]pentylamino]-2-oxoethoxy]phenyl]indole-6-carboxylic acid (PubChem CID 67236217) has the molecular formula C30H40N4O6S and a molecular weight of 584.74 g/mol. Its IUPAC name is 3-cyclohexyl-1-methyl-2-[2-[2-[5-[methyl(sulfamoyl)amino]pentylamino]-2-oxoethoxy]phenyl]indole-6-carboxylic acid.
| Compound Name | 3-cyclohexyl-1-methyl-2-[2-[2-[5-[methyl(sulfamoyl)amino]pentylamino]-2-oxoethoxy]phenyl]indole-6-carboxylic acid |
|---|---|
| PubChem CID | 67236217 |
| Molecular Formula | C30H40N4O6S |
| Molecular Weight | 584.74 g/mol |
| Exact Mass | 584.27 |
| IUPAC Name | 3-cyclohexyl-1-methyl-2-[2-[2-[5-[methyl(sulfamoyl)amino]pentylamino]-2-oxoethoxy]phenyl]indole-6-carboxylic acid |
| SMILES | CN(CCCCCNC(=O)COc1ccccc1-c1c(C2CCCCC2)c2ccc(C(=O)O)cc2n1C)S(N)(=O)=O |
| InChI | InChI=1S/C30H40N4O6S/c1-33(41(31,38)39)18-10-4-9-17-32-27(35)20-40-26-14-8-7-13-24(26)29-28(21-11-5-3-6-12-21)23-16-15-22(30(36)37)19-25(23)34(29)2/h7-8,13-16,19,21H,3-6,9-12,17-18,20H2,1-2H3,(H,32,35)(H,36,37)(H2,31,38,39) |
| InChIKey | YOOWLAJWUZNECG-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 143.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.74 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|