C22H28N4O2S — CID 10295178
3-cyclopentyl-2-[2-[2-(dimethylamino)ethylamino]-1,3-thiazol-4-yl]-1-methylindole-6-carboxylic acid (PubChem CID 10295178) has the molecular formula C22H28N4O2S and a molecular weight of 412.56 g/mol. Its IUPAC name is 3-cyclopentyl-2-[2-[2-(dimethylamino)ethylamino]-1,3-thiazol-4-yl]-1-methylindole-6-carboxylic acid.
| Compound Name | 3-cyclopentyl-2-[2-[2-(dimethylamino)ethylamino]-1,3-thiazol-4-yl]-1-methylindole-6-carboxylic acid |
|---|---|
| PubChem CID | 10295178 |
| Molecular Formula | C22H28N4O2S |
| Molecular Weight | 412.56 g/mol |
| Exact Mass | 412.19 |
| IUPAC Name | 3-cyclopentyl-2-[2-[2-(dimethylamino)ethylamino]-1,3-thiazol-4-yl]-1-methylindole-6-carboxylic acid |
| SMILES | CN(C)CCNc1nc(-c2c(C3CCCC3)c3ccc(C(=O)O)cc3n2C)cs1 |
| InChI | InChI=1S/C22H28N4O2S/c1-25(2)11-10-23-22-24-17(13-29-22)20-19(14-6-4-5-7-14)16-9-8-15(21(27)28)12-18(16)26(20)3/h8-9,12-14H,4-7,10-11H2,1-3H3,(H,23,24)(H,27,28) |
| InChIKey | YEDKYGDONQXMQE-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 70.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.56 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|