C21H22N2O3 — CID 71501727
3-cyclopentyl-2-(6-methoxy-2-pyridinyl)-1-methylindole-6-carboxylic acid (PubChem CID 71501727) has the molecular formula C21H22N2O3 and a molecular weight of 350.42 g/mol. Its IUPAC name is 3-cyclopentyl-2-(6-methoxy-2-pyridinyl)-1-methylindole-6-carboxylic acid.
| Compound Name | 3-cyclopentyl-2-(6-methoxy-2-pyridinyl)-1-methylindole-6-carboxylic acid |
|---|---|
| PubChem CID | 71501727 |
| Molecular Formula | C21H22N2O3 |
| Molecular Weight | 350.42 g/mol |
| Exact Mass | 350.16 |
| IUPAC Name | 3-cyclopentyl-2-(6-methoxy-2-pyridinyl)-1-methylindole-6-carboxylic acid |
| SMILES | COc1cccc(-c2c(C3CCCC3)c3ccc(C(=O)O)cc3n2C)n1 |
| InChI | InChI=1S/C21H22N2O3/c1-23-17-12-14(21(24)25)10-11-15(17)19(13-6-3-4-7-13)20(23)16-8-5-9-18(22-16)26-2/h5,8-13H,3-4,6-7H2,1-2H3,(H,24,25) |
| InChIKey | ZRHYKEOQXLROFZ-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.42 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|