C22H28N2O3 — CID 142207585
ethane;methyl 3-cyclohexyl-1-methyl-2-(1,3-oxazol-5-yl)indole-6-carboxylate (PubChem CID 142207585) has the molecular formula C22H28N2O3 and a molecular weight of 368.48 g/mol. Its IUPAC name is ethane;methyl 3-cyclohexyl-1-methyl-2-(1,3-oxazol-5-yl)indole-6-carboxylate.
| Compound Name | ethane;methyl 3-cyclohexyl-1-methyl-2-(1,3-oxazol-5-yl)indole-6-carboxylate |
|---|---|
| PubChem CID | 142207585 |
| Molecular Formula | C22H28N2O3 |
| Molecular Weight | 368.48 g/mol |
| Exact Mass | 368.21 |
| IUPAC Name | ethane;methyl 3-cyclohexyl-1-methyl-2-(1,3-oxazol-5-yl)indole-6-carboxylate |
| SMILES | CC.COC(=O)c1ccc2c(C3CCCCC3)c(-c3cnco3)n(C)c2c1 |
| InChI | InChI=1S/C20H22N2O3.C2H6/c1-22-16-10-14(20(23)24-2)8-9-15(16)18(13-6-4-3-5-7-13)19(22)17-11-21-12-25-17;1-2/h8-13H,3-7H2,1-2H3;1-2H3 |
| InChIKey | PSAVQBMWRPKRHZ-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 57.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.48 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|