C22H26ClN3O — CID 143166821
1-[2-(5-chloropyrimidin-2-yl)-3-cyclopentyl-1-methylindol-6-yl]ethanone;ethane (PubChem CID 143166821) has the molecular formula C22H26ClN3O and a molecular weight of 383.92 g/mol. Its IUPAC name is 1-[2-(5-chloropyrimidin-2-yl)-3-cyclopentyl-1-methylindol-6-yl]ethanone;ethane.
| Compound Name | 1-[2-(5-chloropyrimidin-2-yl)-3-cyclopentyl-1-methylindol-6-yl]ethanone;ethane |
|---|---|
| PubChem CID | 143166821 |
| Molecular Formula | C22H26ClN3O |
| Molecular Weight | 383.92 g/mol |
| Exact Mass | 383.18 |
| IUPAC Name | 1-[2-(5-chloropyrimidin-2-yl)-3-cyclopentyl-1-methylindol-6-yl]ethanone;ethane |
| SMILES | CC.CC(=O)c1ccc2c(C3CCCC3)c(-c3ncc(Cl)cn3)n(C)c2c1 |
| InChI | InChI=1S/C20H20ClN3O.C2H6/c1-12(25)14-7-8-16-17(9-14)24(2)19(18(16)13-5-3-4-6-13)20-22-10-15(21)11-23-20;1-2/h7-11,13H,3-6H2,1-2H3;1-2H3 |
| InChIKey | KBHJRXIGGAZSPK-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.92 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|