C23H32BNO3 — CID 71084687
methyl 3-cyclopentyl-1-methyl-2-(4,4,5,5-tetramethyloxaborolan-2-yl)indole-6-carboxylate (PubChem CID 71084687) has the molecular formula C23H32BNO3 and a molecular weight of 381.33 g/mol. Its IUPAC name is methyl 3-cyclopentyl-1-methyl-2-(4,4,5,5-tetramethyloxaborolan-2-yl)indole-6-carboxylate.
| Compound Name | methyl 3-cyclopentyl-1-methyl-2-(4,4,5,5-tetramethyloxaborolan-2-yl)indole-6-carboxylate |
|---|---|
| PubChem CID | 71084687 |
| Molecular Formula | C23H32BNO3 |
| Molecular Weight | 381.33 g/mol |
| Exact Mass | 381.25 |
| IUPAC Name | methyl 3-cyclopentyl-1-methyl-2-(4,4,5,5-tetramethyloxaborolan-2-yl)indole-6-carboxylate |
| SMILES | COC(=O)c1ccc2c(C3CCCC3)c(B3CC(C)(C)C(C)(C)O3)n(C)c2c1 |
| InChI | InChI=1S/C23H32BNO3/c1-22(2)14-24(28-23(22,3)4)20-19(15-9-7-8-10-15)17-12-11-16(21(26)27-6)13-18(17)25(20)5/h11-13,15H,7-10,14H2,1-6H3 |
| InChIKey | XRYZNYDVGDDSKE-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 40.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.33 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|