C22H28BN2O3 — CID 67892079
CID 67892079 (PubChem CID 67892079) has the molecular formula C22H28BN2O3 and a molecular weight of 379.29 g/mol.
| Compound Name | CID 67892079 |
|---|---|
| PubChem CID | 67892079 |
| Molecular Formula | C22H28BN2O3 |
| Molecular Weight | 379.29 g/mol |
| Exact Mass | 379.22 |
| IUPAC Name | — |
| SMILES | C[B]c1c(C2CCCC2)c2ccc(C(=O)NC3(C(=O)OC)CCC3)cc2n1C |
| InChI | InChI=1S/C22H28BN2O3/c1-23-19-18(14-7-4-5-8-14)16-10-9-15(13-17(16)25(19)2)20(26)24-22(11-6-12-22)21(27)28-3/h9-10,13-14H,4-8,11-12H2,1-3H3,(H,24,26) |
| InChIKey | CITXCVYRWXOFSH-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 60.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.29 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|