C36H38N4O4 — CID 71455617
(E)-3-[4-[[1-[[3-cyclopentyl-1-methyl-2-(6-methyl-2-pyridinyl)indole-6-carbonyl]amino]cyclobutanecarbonyl]amino]phenyl]-2-methylprop-2-enoic acid (PubChem CID 71455617) has the molecular formula C36H38N4O4 and a molecular weight of 590.72 g/mol. Its IUPAC name is (E)-3-[4-[[1-[[3-cyclopentyl-1-methyl-2-(6-methyl-2-pyridinyl)indole-6-carbonyl]amino]cyclobutanecarbonyl]amino]phenyl]-2-methylprop-2-enoic acid.
| Compound Name | (E)-3-[4-[[1-[[3-cyclopentyl-1-methyl-2-(6-methyl-2-pyridinyl)indole-6-carbonyl]amino]cyclobutanecarbonyl]amino]phenyl]-2-methylprop-2-enoic acid |
|---|---|
| PubChem CID | 71455617 |
| Molecular Formula | C36H38N4O4 |
| Molecular Weight | 590.72 g/mol |
| Exact Mass | 590.29 |
| IUPAC Name | (E)-3-[4-[[1-[[3-cyclopentyl-1-methyl-2-(6-methyl-2-pyridinyl)indole-6-carbonyl]amino]cyclobutanecarbonyl]amino]phenyl]-2-methylprop-2-enoic acid |
| SMILES | C/C(=C\c1ccc(NC(=O)C2(NC(=O)c3ccc4c(C5CCCC5)c(-c5cccc(C)n5)n(C)c4c3)CCC2)cc1)C(=O)O |
| InChI | InChI=1S/C36H38N4O4/c1-22(34(42)43)20-24-12-15-27(16-13-24)38-35(44)36(18-7-19-36)39-33(41)26-14-17-28-30(21-26)40(3)32(29-11-6-8-23(2)37-29)31(28)25-9-4-5-10-25/h6,8,11-17,20-21,25H,4-5,7,9-10,18-19H2,1-3H3,(H,38,44)(H,39,41)(H,42,43)/b22-20+ |
| InChIKey | SFVLWEMOLWCMOJ-LSDHQDQOSA-N |
| XLogP | 6.99 |
| TPSA | 113.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.72 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|