C38H36N4O4 — CID 71462831
(E)-3-[4-[[1-[(3-cyclopentyl-1-methyl-2-quinolin-6-ylindole-6-carbonyl)amino]cyclobutanecarbonyl]amino]phenyl]prop-2-enoic acid (PubChem CID 71462831) has the molecular formula C38H36N4O4 and a molecular weight of 612.73 g/mol. Its IUPAC name is (E)-3-[4-[[1-[(3-cyclopentyl-1-methyl-2-quinolin-6-ylindole-6-carbonyl)amino]cyclobutanecarbonyl]amino]phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[4-[[1-[(3-cyclopentyl-1-methyl-2-quinolin-6-ylindole-6-carbonyl)amino]cyclobutanecarbonyl]amino]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 71462831 |
| Molecular Formula | C38H36N4O4 |
| Molecular Weight | 612.73 g/mol |
| Exact Mass | 612.27 |
| IUPAC Name | (E)-3-[4-[[1-[(3-cyclopentyl-1-methyl-2-quinolin-6-ylindole-6-carbonyl)amino]cyclobutanecarbonyl]amino]phenyl]prop-2-enoic acid |
| SMILES | Cn1c(-c2ccc3ncccc3c2)c(C2CCCC2)c2ccc(C(=O)NC3(C(=O)Nc4ccc(/C=C/C(=O)O)cc4)CCC3)cc21 |
| InChI | InChI=1S/C38H36N4O4/c1-42-32-23-28(36(45)41-38(19-5-20-38)37(46)40-29-14-9-24(10-15-29)11-18-33(43)44)12-16-30(32)34(25-6-2-3-7-25)35(42)27-13-17-31-26(22-27)8-4-21-39-31/h4,8-18,21-23,25H,2-3,5-7,19-20H2,1H3,(H,40,46)(H,41,45)(H,43,44)/b18-11+ |
| InChIKey | OSRWABOJZUEBDO-WOJGMQOQSA-N |
| XLogP | 7.44 |
| TPSA | 113.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.73 |
| LogP ≤ 5 | 7.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|