C38H40N4O4 — CID 11599766
(E)-3-[4-[[1-[(18-cyclohexyl-6,11-diazatetracyclo[9.7.0.02,7.012,17]octadeca-1(18),2(7),3,5,12(17),13,15-heptaene-14-carbonyl)amino]cyclopentanecarbonyl]amino]phenyl]prop-2-enoic acid (PubChem CID 11599766) has the molecular formula C38H40N4O4 and a molecular weight of 616.76 g/mol. Its IUPAC name is (E)-3-[4-[[1-[(18-cyclohexyl-6,11-diazatetracyclo[9.7.0.02,7.012,17]octadeca-1(18),2(7),3,5,12(17),13,15-heptaene-14-carbonyl)amino]cyclopentanecarbonyl]amino]phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[4-[[1-[(18-cyclohexyl-6,11-diazatetracyclo[9.7.0.02,7.012,17]octadeca-1(18),2(7),3,5,12(17),13,15-heptaene-14-carbonyl)amino]cyclopentanecarbonyl]amino]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 11599766 |
| Molecular Formula | C38H40N4O4 |
| Molecular Weight | 616.76 g/mol |
| Exact Mass | 616.30 |
| IUPAC Name | (E)-3-[4-[[1-[(18-cyclohexyl-6,11-diazatetracyclo[9.7.0.02,7.012,17]octadeca-1(18),2(7),3,5,12(17),13,15-heptaene-14-carbonyl)amino]cyclopentanecarbonyl]amino]phenyl]prop-2-enoic acid |
| SMILES | O=C(O)/C=C/c1ccc(NC(=O)C2(NC(=O)c3ccc4c(C5CCCCC5)c5n(c4c3)CCCc3ncccc3-5)CCCC2)cc1 |
| InChI | InChI=1S/C38H40N4O4/c43-33(44)19-14-25-12-16-28(17-13-25)40-37(46)38(20-4-5-21-38)41-36(45)27-15-18-30-32(24-27)42-23-7-11-31-29(10-6-22-39-31)35(42)34(30)26-8-2-1-3-9-26/h6,10,12-19,22,24,26H,1-5,7-9,11,20-21,23H2,(H,40,46)(H,41,45)(H,43,44)/b19-14+ |
| InChIKey | WMKVWVGWAUTQRC-XMHGGMMESA-N |
| XLogP | 7.48 |
| TPSA | 113.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.76 |
| LogP ≤ 5 | 7.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|