C38H41N3O5 — CID 11498191
methyl (E)-3-[4-[[1-[(17-cyclohexyl-5-oxa-10-azatetracyclo[8.7.0.02,6.011,16]heptadeca-1(17),2(6),3,11(16),12,14-hexaene-13-carbonyl)amino]cyclopentanecarbonyl]amino]phenyl]prop-2-enoate (PubChem CID 11498191) has the molecular formula C38H41N3O5 and a molecular weight of 619.76 g/mol. Its IUPAC name is methyl (E)-3-[4-[[1-[(17-cyclohexyl-5-oxa-10-azatetracyclo[8.7.0.02,6.011,16]heptadeca-1(17),2(6),3,11(16),12,14-hexaene-13-carbonyl)amino]cyclopentanecarbonyl]amino]phenyl]prop-2-enoate.
| Compound Name | methyl (E)-3-[4-[[1-[(17-cyclohexyl-5-oxa-10-azatetracyclo[8.7.0.02,6.011,16]heptadeca-1(17),2(6),3,11(16),12,14-hexaene-13-carbonyl)amino]cyclopentanecarbonyl]amino]phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 11498191 |
| Molecular Formula | C38H41N3O5 |
| Molecular Weight | 619.76 g/mol |
| Exact Mass | 619.30 |
| IUPAC Name | methyl (E)-3-[4-[[1-[(17-cyclohexyl-5-oxa-10-azatetracyclo[8.7.0.02,6.011,16]heptadeca-1(17),2(6),3,11(16),12,14-hexaene-13-carbonyl)amino]cyclopentanecarbonyl]amino]phenyl]prop-2-enoate |
| SMILES | COC(=O)/C=C/c1ccc(NC(=O)C2(NC(=O)c3ccc4c(C5CCCCC5)c5n(c4c3)CCCc3occc3-5)CCCC2)cc1 |
| InChI | InChI=1S/C38H41N3O5/c1-45-33(42)18-13-25-11-15-28(16-12-25)39-37(44)38(20-5-6-21-38)40-36(43)27-14-17-29-31(24-27)41-22-7-10-32-30(19-23-46-32)35(41)34(29)26-8-3-2-4-9-26/h11-19,23-24,26H,2-10,20-22H2,1H3,(H,39,44)(H,40,43)/b18-13+ |
| InChIKey | YAUIWIWOMOKMIH-QGOAFFKASA-N |
| XLogP | 7.76 |
| TPSA | 102.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.76 |
| LogP ≤ 5 | 7.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|