C31H34N4O5 — CID 66969179
3-[4-[[1-[(2-carbamoyl-3-cyclopentyl-1-methylindole-6-carbonyl)amino]cyclopentanecarbonyl]amino]phenyl]prop-2-enoic acid (PubChem CID 66969179) has the molecular formula C31H34N4O5 and a molecular weight of 542.64 g/mol. Its IUPAC name is 3-[4-[[1-[(2-carbamoyl-3-cyclopentyl-1-methylindole-6-carbonyl)amino]cyclopentanecarbonyl]amino]phenyl]prop-2-enoic acid.
| Compound Name | 3-[4-[[1-[(2-carbamoyl-3-cyclopentyl-1-methylindole-6-carbonyl)amino]cyclopentanecarbonyl]amino]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 66969179 |
| Molecular Formula | C31H34N4O5 |
| Molecular Weight | 542.64 g/mol |
| Exact Mass | 542.25 |
| IUPAC Name | 3-[4-[[1-[(2-carbamoyl-3-cyclopentyl-1-methylindole-6-carbonyl)amino]cyclopentanecarbonyl]amino]phenyl]prop-2-enoic acid |
| SMILES | Cn1c(C(N)=O)c(C2CCCC2)c2ccc(C(=O)NC3(C(=O)Nc4ccc(C=CC(=O)O)cc4)CCCC3)cc21 |
| InChI | InChI=1S/C31H34N4O5/c1-35-24-18-21(11-14-23(24)26(27(35)28(32)38)20-6-2-3-7-20)29(39)34-31(16-4-5-17-31)30(40)33-22-12-8-19(9-13-22)10-15-25(36)37/h8-15,18,20H,2-7,16-17H2,1H3,(H2,32,38)(H,33,40)(H,34,39)(H,36,37) |
| InChIKey | AFLUAWGYNYIWDY-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 143.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.64 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|