C39H41N5O5 — CID 10462019
(E)-3-[4-[[1-[[3-cyclopentyl-1-(2-oxo-2-pyrrolidin-1-ylethyl)-2-pyridin-2-ylindole-6-carbonyl]amino]cyclobutanecarbonyl]amino]phenyl]prop-2-enoic acid (PubChem CID 10462019) has the molecular formula C39H41N5O5 and a molecular weight of 659.79 g/mol. Its IUPAC name is (E)-3-[4-[[1-[[3-cyclopentyl-1-(2-oxo-2-pyrrolidin-1-ylethyl)-2-pyridin-2-ylindole-6-carbonyl]amino]cyclobutanecarbonyl]amino]phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[4-[[1-[[3-cyclopentyl-1-(2-oxo-2-pyrrolidin-1-ylethyl)-2-pyridin-2-ylindole-6-carbonyl]amino]cyclobutanecarbonyl]amino]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 10462019 |
| Molecular Formula | C39H41N5O5 |
| Molecular Weight | 659.79 g/mol |
| Exact Mass | 659.31 |
| IUPAC Name | (E)-3-[4-[[1-[[3-cyclopentyl-1-(2-oxo-2-pyrrolidin-1-ylethyl)-2-pyridin-2-ylindole-6-carbonyl]amino]cyclobutanecarbonyl]amino]phenyl]prop-2-enoic acid |
| SMILES | O=C(O)/C=C/c1ccc(NC(=O)C2(NC(=O)c3ccc4c(C5CCCC5)c(-c5ccccn5)n(CC(=O)N5CCCC5)c4c3)CCC2)cc1 |
| InChI | InChI=1S/C39H41N5O5/c45-33(43-22-5-6-23-43)25-44-32-24-28(14-17-30(32)35(27-8-1-2-9-27)36(44)31-10-3-4-21-40-31)37(48)42-39(19-7-20-39)38(49)41-29-15-11-26(12-16-29)13-18-34(46)47/h3-4,10-18,21,24,27H,1-2,5-9,19-20,22-23,25H2,(H,41,49)(H,42,48)(H,46,47)/b18-13+ |
| InChIKey | ZLTFIEZIIQWWSK-QGOAFFKASA-N |
| XLogP | 6.37 |
| TPSA | 133.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.79 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|