C37H40N4O6 — CID 118720677
(E)-3-[4-[[1-[(3-cyclopentyl-1-methyl-2-pyridin-2-ylindole-6-carbonyl)amino]cyclobutanecarbonyl]amino]-2-(2-methoxyethoxy)phenyl]prop-2-enoic acid (PubChem CID 118720677) has the molecular formula C37H40N4O6 and a molecular weight of 636.75 g/mol. Its IUPAC name is (E)-3-[4-[[1-[(3-cyclopentyl-1-methyl-2-pyridin-2-ylindole-6-carbonyl)amino]cyclobutanecarbonyl]amino]-2-(2-methoxyethoxy)phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[4-[[1-[(3-cyclopentyl-1-methyl-2-pyridin-2-ylindole-6-carbonyl)amino]cyclobutanecarbonyl]amino]-2-(2-methoxyethoxy)phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 118720677 |
| Molecular Formula | C37H40N4O6 |
| Molecular Weight | 636.75 g/mol |
| Exact Mass | 636.29 |
| IUPAC Name | (E)-3-[4-[[1-[(3-cyclopentyl-1-methyl-2-pyridin-2-ylindole-6-carbonyl)amino]cyclobutanecarbonyl]amino]-2-(2-methoxyethoxy)phenyl]prop-2-enoic acid |
| SMILES | COCCOc1cc(NC(=O)C2(NC(=O)c3ccc4c(C5CCCC5)c(-c5ccccn5)n(C)c4c3)CCC2)ccc1/C=C/C(=O)O |
| InChI | InChI=1S/C37H40N4O6/c1-41-30-22-26(12-15-28(30)33(25-8-3-4-9-25)34(41)29-10-5-6-19-38-29)35(44)40-37(17-7-18-37)36(45)39-27-14-11-24(13-16-32(42)43)31(23-27)47-21-20-46-2/h5-6,10-16,19,22-23,25H,3-4,7-9,17-18,20-21H2,1-2H3,(H,39,45)(H,40,44)(H,42,43)/b16-13+ |
| InChIKey | GHGLSKSKIAOTFO-DTQAZKPQSA-N |
| XLogP | 6.31 |
| TPSA | 131.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.75 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|