C24H29BrN2O5 — CID 21105283
methyl 2-(2-bromoacetyl)-3-cyclohexyl-1-(2-morpholin-4-yl-2-oxoethyl)indole-6-carboxylate (PubChem CID 21105283) has the molecular formula C24H29BrN2O5 and a molecular weight of 505.41 g/mol. Its IUPAC name is methyl 2-(2-bromoacetyl)-3-cyclohexyl-1-(2-morpholin-4-yl-2-oxoethyl)indole-6-carboxylate.
| Compound Name | methyl 2-(2-bromoacetyl)-3-cyclohexyl-1-(2-morpholin-4-yl-2-oxoethyl)indole-6-carboxylate |
|---|---|
| PubChem CID | 21105283 |
| Molecular Formula | C24H29BrN2O5 |
| Molecular Weight | 505.41 g/mol |
| Exact Mass | 504.13 |
| IUPAC Name | methyl 2-(2-bromoacetyl)-3-cyclohexyl-1-(2-morpholin-4-yl-2-oxoethyl)indole-6-carboxylate |
| SMILES | COC(=O)c1ccc2c(C3CCCCC3)c(C(=O)CBr)n(CC(=O)N3CCOCC3)c2c1 |
| InChI | InChI=1S/C24H29BrN2O5/c1-31-24(30)17-7-8-18-19(13-17)27(15-21(29)26-9-11-32-12-10-26)23(20(28)14-25)22(18)16-5-3-2-4-6-16/h7-8,13,16H,2-6,9-12,14-15H2,1H3 |
| InChIKey | DONPZFGUZKFHOM-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 77.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.41 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|