C25H28N2O4S — CID 10026886
3-cyclohexyl-1-(2-morpholin-4-yl-2-oxoethyl)-2-thiophen-3-ylindole-6-carboxylic acid (PubChem CID 10026886) has the molecular formula C25H28N2O4S and a molecular weight of 452.58 g/mol. Its IUPAC name is 3-cyclohexyl-1-(2-morpholin-4-yl-2-oxoethyl)-2-thiophen-3-ylindole-6-carboxylic acid.
| Compound Name | 3-cyclohexyl-1-(2-morpholin-4-yl-2-oxoethyl)-2-thiophen-3-ylindole-6-carboxylic acid |
|---|---|
| PubChem CID | 10026886 |
| Molecular Formula | C25H28N2O4S |
| Molecular Weight | 452.58 g/mol |
| Exact Mass | 452.18 |
| IUPAC Name | 3-cyclohexyl-1-(2-morpholin-4-yl-2-oxoethyl)-2-thiophen-3-ylindole-6-carboxylic acid |
| SMILES | O=C(O)c1ccc2c(C3CCCCC3)c(-c3ccsc3)n(CC(=O)N3CCOCC3)c2c1 |
| InChI | InChI=1S/C25H28N2O4S/c28-22(26-9-11-31-12-10-26)15-27-21-14-18(25(29)30)6-7-20(21)23(17-4-2-1-3-5-17)24(27)19-8-13-32-16-19/h6-8,13-14,16-17H,1-5,9-12,15H2,(H,29,30) |
| InChIKey | QYTLFUPVASIOAZ-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 71.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.58 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |