C36H36N4O4 — CID 58710351
2-[2-(3-aminophenyl)quinolin-6-yl]-3-cyclohexyl-1-(2-morpholin-4-yl-2-oxoethyl)indole-6-carboxylic acid (PubChem CID 58710351) has the molecular formula C36H36N4O4 and a molecular weight of 588.71 g/mol. Its IUPAC name is 2-[2-(3-aminophenyl)quinolin-6-yl]-3-cyclohexyl-1-(2-morpholin-4-yl-2-oxoethyl)indole-6-carboxylic acid.
| Compound Name | 2-[2-(3-aminophenyl)quinolin-6-yl]-3-cyclohexyl-1-(2-morpholin-4-yl-2-oxoethyl)indole-6-carboxylic acid |
|---|---|
| PubChem CID | 58710351 |
| Molecular Formula | C36H36N4O4 |
| Molecular Weight | 588.71 g/mol |
| Exact Mass | 588.27 |
| IUPAC Name | 2-[2-(3-aminophenyl)quinolin-6-yl]-3-cyclohexyl-1-(2-morpholin-4-yl-2-oxoethyl)indole-6-carboxylic acid |
| SMILES | Nc1cccc(-c2ccc3cc(-c4c(C5CCCCC5)c5ccc(C(=O)O)cc5n4CC(=O)N4CCOCC4)ccc3n2)c1 |
| InChI | InChI=1S/C36H36N4O4/c37-28-8-4-7-24(20-28)30-13-10-25-19-26(11-14-31(25)38-30)35-34(23-5-2-1-3-6-23)29-12-9-27(36(42)43)21-32(29)40(35)22-33(41)39-15-17-44-18-16-39/h4,7-14,19-21,23H,1-3,5-6,15-18,22,37H2,(H,42,43) |
| InChIKey | QWHVNDPFEYMCDP-UHFFFAOYSA-N |
| XLogP | 6.71 |
| TPSA | 110.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.71 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|