C36H37N3O3 — CID 141146520
2-[3-cyclohexyl-2-[2-(3-methoxyphenyl)quinolin-6-yl]indol-1-yl]-1-morpholin-4-ylethanone (PubChem CID 141146520) has the molecular formula C36H37N3O3 and a molecular weight of 559.71 g/mol. Its IUPAC name is 2-[3-cyclohexyl-2-[2-(3-methoxyphenyl)quinolin-6-yl]indol-1-yl]-1-morpholin-4-ylethanone.
| Compound Name | 2-[3-cyclohexyl-2-[2-(3-methoxyphenyl)quinolin-6-yl]indol-1-yl]-1-morpholin-4-ylethanone |
|---|---|
| PubChem CID | 141146520 |
| Molecular Formula | C36H37N3O3 |
| Molecular Weight | 559.71 g/mol |
| Exact Mass | 559.28 |
| IUPAC Name | 2-[3-cyclohexyl-2-[2-(3-methoxyphenyl)quinolin-6-yl]indol-1-yl]-1-morpholin-4-ylethanone |
| SMILES | COc1cccc(-c2ccc3cc(-c4c(C5CCCCC5)c5ccccc5n4CC(=O)N4CCOCC4)ccc3n2)c1 |
| InChI | InChI=1S/C36H37N3O3/c1-41-29-11-7-10-26(23-29)31-16-14-27-22-28(15-17-32(27)37-31)36-35(25-8-3-2-4-9-25)30-12-5-6-13-33(30)39(36)24-34(40)38-18-20-42-21-19-38/h5-7,10-17,22-23,25H,2-4,8-9,18-21,24H2,1H3 |
| InChIKey | VJHLKYXWRJLGKJ-UHFFFAOYSA-N |
| XLogP | 7.44 |
| TPSA | 56.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.71 |
| LogP ≤ 5 | 7.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |