C40H44N4O9S — CID 11563981
[3-cyclohexyl-2-[2-(2,4-dimethyl-1,3-thiazol-5-yl)quinolin-6-yl]-1-(2-morpholin-4-yl-2-oxoethyl)indol-6-yl] (2S,3S,4S,5R,6R)-3,4,5,6-tetrahydroxyoxane-2-carboxylate (PubChem CID 11563981) has the molecular formula C40H44N4O9S and a molecular weight of 756.88 g/mol. Its IUPAC name is [3-cyclohexyl-2-[2-(2,4-dimethyl-1,3-thiazol-5-yl)quinolin-6-yl]-1-(2-morpholin-4-yl-2-oxoethyl)indol-6-yl] (2S,3S,4S,5R,6R)-3,4,5,6-tetrahydroxyoxane-2-carboxylate.
| Compound Name | [3-cyclohexyl-2-[2-(2,4-dimethyl-1,3-thiazol-5-yl)quinolin-6-yl]-1-(2-morpholin-4-yl-2-oxoethyl)indol-6-yl] (2S,3S,4S,5R,6R)-3,4,5,6-tetrahydroxyoxane-2-carboxylate |
|---|---|
| PubChem CID | 11563981 |
| Molecular Formula | C40H44N4O9S |
| Molecular Weight | 756.88 g/mol |
| Exact Mass | 756.28 |
| IUPAC Name | [3-cyclohexyl-2-[2-(2,4-dimethyl-1,3-thiazol-5-yl)quinolin-6-yl]-1-(2-morpholin-4-yl-2-oxoethyl)indol-6-yl] (2S,3S,4S,5R,6R)-3,4,5,6-tetrahydroxyoxane-2-carboxylate |
| SMILES | Cc1nc(C)c(-c2ccc3cc(-c4c(C5CCCCC5)c5ccc(OC(=O)[C@H]6O[C@@H](O)[C@H](O)[C@@H](O)[C@@H]6O)cc5n4CC(=O)N4CCOCC4)ccc3n2)s1 |
| InChI | InChI=1S/C40H44N4O9S/c1-21-38(54-22(2)41-21)29-13-8-24-18-25(9-12-28(24)42-29)33-32(23-6-4-3-5-7-23)27-11-10-26(52-40(50)37-35(47)34(46)36(48)39(49)53-37)19-30(27)44(33)20-31(45)43-14-16-51-17-15-43/h8-13,18-19,23,34-37,39,46-49H,3-7,14-17,20H2,1-2H3/t34-,35-,36+,37-,39+/m0/s1 |
| InChIKey | CZHBXKBQKXRVPD-HAHISVAYSA-N |
| XLogP | 4.21 |
| TPSA | 176.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 756.88 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|