C35H35N5O6S — CID 11549185
3-cyclohexyl-2-[2-(2,4-dimethyl-1,3-thiazol-5-yl)-8-nitroquinolin-6-yl]-1-(2-morpholin-4-yl-2-oxoethyl)indole-6-carboxylic acid (PubChem CID 11549185) has the molecular formula C35H35N5O6S and a molecular weight of 653.76 g/mol. Its IUPAC name is 3-cyclohexyl-2-[2-(2,4-dimethyl-1,3-thiazol-5-yl)-8-nitroquinolin-6-yl]-1-(2-morpholin-4-yl-2-oxoethyl)indole-6-carboxylic acid.
| Compound Name | 3-cyclohexyl-2-[2-(2,4-dimethyl-1,3-thiazol-5-yl)-8-nitroquinolin-6-yl]-1-(2-morpholin-4-yl-2-oxoethyl)indole-6-carboxylic acid |
|---|---|
| PubChem CID | 11549185 |
| Molecular Formula | C35H35N5O6S |
| Molecular Weight | 653.76 g/mol |
| Exact Mass | 653.23 |
| IUPAC Name | 3-cyclohexyl-2-[2-(2,4-dimethyl-1,3-thiazol-5-yl)-8-nitroquinolin-6-yl]-1-(2-morpholin-4-yl-2-oxoethyl)indole-6-carboxylic acid |
| SMILES | Cc1nc(C)c(-c2ccc3cc(-c4c(C5CCCCC5)c5ccc(C(=O)O)cc5n4CC(=O)N4CCOCC4)cc([N+](=O)[O-])c3n2)s1 |
| InChI | InChI=1S/C35H35N5O6S/c1-20-34(47-21(2)36-20)27-11-9-23-16-25(18-29(40(44)45)32(23)37-27)33-31(22-6-4-3-5-7-22)26-10-8-24(35(42)43)17-28(26)39(33)19-30(41)38-12-14-46-15-13-38/h8-11,16-18,22H,3-7,12-15,19H2,1-2H3,(H,42,43) |
| InChIKey | OVKWILLGAMYXLN-UHFFFAOYSA-N |
| XLogP | 7.11 |
| TPSA | 140.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.76 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|