C31H32FN3O2 — CID 141146536
2-[3-cyclohexyl-2-[4-(2-fluoro-3-pyridinyl)phenyl]indol-1-yl]-1-morpholin-4-ylethanone (PubChem CID 141146536) has the molecular formula C31H32FN3O2 and a molecular weight of 497.61 g/mol. Its IUPAC name is 2-[3-cyclohexyl-2-[4-(2-fluoro-3-pyridinyl)phenyl]indol-1-yl]-1-morpholin-4-ylethanone.
| Compound Name | 2-[3-cyclohexyl-2-[4-(2-fluoro-3-pyridinyl)phenyl]indol-1-yl]-1-morpholin-4-ylethanone |
|---|---|
| PubChem CID | 141146536 |
| Molecular Formula | C31H32FN3O2 |
| Molecular Weight | 497.61 g/mol |
| Exact Mass | 497.25 |
| IUPAC Name | 2-[3-cyclohexyl-2-[4-(2-fluoro-3-pyridinyl)phenyl]indol-1-yl]-1-morpholin-4-ylethanone |
| SMILES | O=C(Cn1c(-c2ccc(-c3cccnc3F)cc2)c(C2CCCCC2)c2ccccc21)N1CCOCC1 |
| InChI | InChI=1S/C31H32FN3O2/c32-31-25(10-6-16-33-31)22-12-14-24(15-13-22)30-29(23-7-2-1-3-8-23)26-9-4-5-11-27(26)35(30)21-28(36)34-17-19-37-20-18-34/h4-6,9-16,23H,1-3,7-8,17-21H2 |
| InChIKey | KLLVGWBUDYKHBB-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.61 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|