C36H36N6O3 — CID 58111269
(E)-3-[2-[1-[[2-(6-amino-2-pyridinyl)-3-cyclopentyl-1-methylindole-6-carbonyl]amino]cyclopent-3-en-1-yl]-1-methylbenzimidazol-5-yl]prop-2-enoic acid (PubChem CID 58111269) has the molecular formula C36H36N6O3 and a molecular weight of 600.72 g/mol. Its IUPAC name is (E)-3-[2-[1-[[2-(6-amino-2-pyridinyl)-3-cyclopentyl-1-methylindole-6-carbonyl]amino]cyclopent-3-en-1-yl]-1-methylbenzimidazol-5-yl]prop-2-enoic acid.
| Compound Name | (E)-3-[2-[1-[[2-(6-amino-2-pyridinyl)-3-cyclopentyl-1-methylindole-6-carbonyl]amino]cyclopent-3-en-1-yl]-1-methylbenzimidazol-5-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 58111269 |
| Molecular Formula | C36H36N6O3 |
| Molecular Weight | 600.72 g/mol |
| Exact Mass | 600.28 |
| IUPAC Name | (E)-3-[2-[1-[[2-(6-amino-2-pyridinyl)-3-cyclopentyl-1-methylindole-6-carbonyl]amino]cyclopent-3-en-1-yl]-1-methylbenzimidazol-5-yl]prop-2-enoic acid |
| SMILES | Cn1c(C2(NC(=O)c3ccc4c(C5CCCC5)c(-c5cccc(N)n5)n(C)c4c3)CC=CC2)nc2cc(/C=C/C(=O)O)ccc21 |
| InChI | InChI=1S/C36H36N6O3/c1-41-29-21-24(14-15-25(29)32(23-8-3-4-9-23)33(41)26-10-7-11-30(37)38-26)34(45)40-36(18-5-6-19-36)35-39-27-20-22(13-17-31(43)44)12-16-28(27)42(35)2/h5-7,10-17,20-21,23H,3-4,8-9,18-19H2,1-2H3,(H2,37,38)(H,40,45)(H,43,44)/b17-13+ |
| InChIKey | NCDJHSDVNAXHSU-GHRIWEEISA-N |
| XLogP | 6.44 |
| TPSA | 128.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.72 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|