C34H33BrN6NaO3 — CID 71761283
CID 71761283 (PubChem CID 71761283) has the molecular formula C34H33BrN6NaO3 and a molecular weight of 676.57 g/mol.
| Compound Name | CID 71761283 |
|---|---|
| PubChem CID | 71761283 |
| Molecular Formula | C34H33BrN6NaO3 |
| Molecular Weight | 676.57 g/mol |
| Exact Mass | 675.17 |
| IUPAC Name | — |
| SMILES | Cn1c(C2(NC(=O)c3ccc4c(C5CCCC5)c(-c5ncc(Br)cn5)n(C)c4c3)CCC2)nc2ccc(/C=C/C(=O)O)cc21.[Na] |
| InChI | InChI=1S/C34H33BrN6O3.Na/c1-40-26-17-22(10-11-24(26)29(21-6-3-4-7-21)30(40)31-36-18-23(35)19-37-31)32(44)39-34(14-5-15-34)33-38-25-12-8-20(9-13-28(42)43)16-27(25)41(33)2;/h8-13,16-19,21H,3-7,14-15H2,1-2H3,(H,39,44)(H,42,43);/b13-9+; |
| InChIKey | OHAQXFVKVXWFPE-KJEVSKRMSA-N |
| XLogP | 6.47 |
| TPSA | 114.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.57 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|