C34H35N5O2S — CID 88976468
3-cyclopentyl-1-methyl-N-[1-[1-methyl-5-[(E)-3-oxobut-1-enyl]benzimidazol-2-yl]cyclobutyl]-2-(1,3-thiazol-2-yl)indole-6-carboxamide (PubChem CID 88976468) has the molecular formula C34H35N5O2S and a molecular weight of 577.75 g/mol. Its IUPAC name is 3-cyclopentyl-1-methyl-N-[1-[1-methyl-5-[(E)-3-oxobut-1-enyl]benzimidazol-2-yl]cyclobutyl]-2-(1,3-thiazol-2-yl)indole-6-carboxamide.
| Compound Name | 3-cyclopentyl-1-methyl-N-[1-[1-methyl-5-[(E)-3-oxobut-1-enyl]benzimidazol-2-yl]cyclobutyl]-2-(1,3-thiazol-2-yl)indole-6-carboxamide |
|---|---|
| PubChem CID | 88976468 |
| Molecular Formula | C34H35N5O2S |
| Molecular Weight | 577.75 g/mol |
| Exact Mass | 577.25 |
| IUPAC Name | 3-cyclopentyl-1-methyl-N-[1-[1-methyl-5-[(E)-3-oxobut-1-enyl]benzimidazol-2-yl]cyclobutyl]-2-(1,3-thiazol-2-yl)indole-6-carboxamide |
| SMILES | CC(=O)/C=C/c1ccc2c(c1)nc(C1(NC(=O)c3ccc4c(C5CCCC5)c(-c5nccs5)n(C)c4c3)CCC1)n2C |
| InChI | InChI=1S/C34H35N5O2S/c1-21(40)9-10-22-11-14-27-26(19-22)36-33(39(27)3)34(15-6-16-34)37-31(41)24-12-13-25-28(20-24)38(2)30(32-35-17-18-42-32)29(25)23-7-4-5-8-23/h9-14,17-20,23H,4-8,15-16H2,1-3H3,(H,37,41)/b10-9+ |
| InChIKey | SALNBJRYFMMDQT-MDZDMXLPSA-N |
| XLogP | 7.26 |
| TPSA | 81.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.75 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|