C24H27NO — CID 142999777
1-(3-cycloheptyl-1-methyl-2-phenylindol-6-yl)ethenol (PubChem CID 142999777) has the molecular formula C24H27NO and a molecular weight of 345.49 g/mol. Its IUPAC name is 1-(3-cycloheptyl-1-methyl-2-phenylindol-6-yl)ethenol.
| Compound Name | 1-(3-cycloheptyl-1-methyl-2-phenylindol-6-yl)ethenol |
|---|---|
| PubChem CID | 142999777 |
| Molecular Formula | C24H27NO |
| Molecular Weight | 345.49 g/mol |
| Exact Mass | 345.21 |
| IUPAC Name | 1-(3-cycloheptyl-1-methyl-2-phenylindol-6-yl)ethenol |
| SMILES | C=C(O)c1ccc2c(C3CCCCCC3)c(-c3ccccc3)n(C)c2c1 |
| InChI | InChI=1S/C24H27NO/c1-17(26)20-14-15-21-22(16-20)25(2)24(19-12-8-5-9-13-19)23(21)18-10-6-3-4-7-11-18/h5,8-9,12-16,18,26H,1,3-4,6-7,10-11H2,2H3 |
| InChIKey | SUAYKVOYQYSMBA-UHFFFAOYSA-N |
| XLogP | 6.81 |
| TPSA | 25.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.49 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|