C37H37N5O4S — CID 54585636
(E)-3-[4-[[2-[[3-cyclohexyl-1-methyl-2-(2-pyridin-3-yl-1,3-thiazol-4-yl)indole-6-carbonyl]amino]-2-methylpropanoyl]amino]phenyl]prop-2-enoic acid (PubChem CID 54585636) has the molecular formula C37H37N5O4S and a molecular weight of 647.80 g/mol. Its IUPAC name is (E)-3-[4-[[2-[[3-cyclohexyl-1-methyl-2-(2-pyridin-3-yl-1,3-thiazol-4-yl)indole-6-carbonyl]amino]-2-methylpropanoyl]amino]phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[4-[[2-[[3-cyclohexyl-1-methyl-2-(2-pyridin-3-yl-1,3-thiazol-4-yl)indole-6-carbonyl]amino]-2-methylpropanoyl]amino]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 54585636 |
| Molecular Formula | C37H37N5O4S |
| Molecular Weight | 647.80 g/mol |
| Exact Mass | 647.26 |
| IUPAC Name | (E)-3-[4-[[2-[[3-cyclohexyl-1-methyl-2-(2-pyridin-3-yl-1,3-thiazol-4-yl)indole-6-carbonyl]amino]-2-methylpropanoyl]amino]phenyl]prop-2-enoic acid |
| SMILES | Cn1c(-c2csc(-c3cccnc3)n2)c(C2CCCCC2)c2ccc(C(=O)NC(C)(C)C(=O)Nc3ccc(/C=C/C(=O)O)cc3)cc21 |
| InChI | InChI=1S/C37H37N5O4S/c1-37(2,36(46)39-27-15-11-23(12-16-27)13-18-31(43)44)41-34(45)25-14-17-28-30(20-25)42(3)33(32(28)24-8-5-4-6-9-24)29-22-47-35(40-29)26-10-7-19-38-21-26/h7,10-22,24H,4-6,8-9H2,1-3H3,(H,39,46)(H,41,45)(H,43,44)/b18-13+ |
| InChIKey | SVTPIZAKPURYLT-QGOAFFKASA-N |
| XLogP | 7.66 |
| TPSA | 126.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.80 |
| LogP ≤ 5 | 7.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|