C29H38N4O5S — CID 143940399
2-[2-[6-[[4-aminobutyl(methyl)sulfinamoyl]carbamoyl]-3-cyclohexyl-1-methylindol-2-yl]phenoxy]acetic acid (PubChem CID 143940399) has the molecular formula C29H38N4O5S and a molecular weight of 554.71 g/mol. Its IUPAC name is 2-[2-[6-[[4-aminobutyl(methyl)sulfinamoyl]carbamoyl]-3-cyclohexyl-1-methylindol-2-yl]phenoxy]acetic acid.
| Compound Name | 2-[2-[6-[[4-aminobutyl(methyl)sulfinamoyl]carbamoyl]-3-cyclohexyl-1-methylindol-2-yl]phenoxy]acetic acid |
|---|---|
| PubChem CID | 143940399 |
| Molecular Formula | C29H38N4O5S |
| Molecular Weight | 554.71 g/mol |
| Exact Mass | 554.26 |
| IUPAC Name | 2-[2-[6-[[4-aminobutyl(methyl)sulfinamoyl]carbamoyl]-3-cyclohexyl-1-methylindol-2-yl]phenoxy]acetic acid |
| SMILES | CN(CCCCN)S(=O)NC(=O)c1ccc2c(C3CCCCC3)c(-c3ccccc3OCC(=O)O)n(C)c2c1 |
| InChI | InChI=1S/C29H38N4O5S/c1-32(17-9-8-16-30)39(37)31-29(36)21-14-15-22-24(18-21)33(2)28(27(22)20-10-4-3-5-11-20)23-12-6-7-13-25(23)38-19-26(34)35/h6-7,12-15,18,20H,3-5,8-11,16-17,19,30H2,1-2H3,(H,31,36)(H,34,35) |
| InChIKey | RKONTECHLQZGTJ-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 126.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.71 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|