C37H43FN4O8S — CID 67226426
methyl 3-cyclohexyl-2-[4-fluoro-2-[2-[5-[methyl-(2-nitrophenyl)sulfonylamino]pentylamino]-2-oxoethoxy]phenyl]-1-methylindole-6-carboxylate (PubChem CID 67226426) has the molecular formula C37H43FN4O8S and a molecular weight of 722.84 g/mol. Its IUPAC name is methyl 3-cyclohexyl-2-[4-fluoro-2-[2-[5-[methyl-(2-nitrophenyl)sulfonylamino]pentylamino]-2-oxoethoxy]phenyl]-1-methylindole-6-carboxylate.
| Compound Name | methyl 3-cyclohexyl-2-[4-fluoro-2-[2-[5-[methyl-(2-nitrophenyl)sulfonylamino]pentylamino]-2-oxoethoxy]phenyl]-1-methylindole-6-carboxylate |
|---|---|
| PubChem CID | 67226426 |
| Molecular Formula | C37H43FN4O8S |
| Molecular Weight | 722.84 g/mol |
| Exact Mass | 722.28 |
| IUPAC Name | methyl 3-cyclohexyl-2-[4-fluoro-2-[2-[5-[methyl-(2-nitrophenyl)sulfonylamino]pentylamino]-2-oxoethoxy]phenyl]-1-methylindole-6-carboxylate |
| SMILES | COC(=O)c1ccc2c(C3CCCCC3)c(-c3ccc(F)cc3OCC(=O)NCCCCCN(C)S(=O)(=O)c3ccccc3[N+](=O)[O-])n(C)c2c1 |
| InChI | InChI=1S/C37H43FN4O8S/c1-40(51(47,48)33-15-9-8-14-30(33)42(45)46)21-11-5-10-20-39-34(43)24-50-32-23-27(38)17-19-29(32)36-35(25-12-6-4-7-13-25)28-18-16-26(37(44)49-3)22-31(28)41(36)2/h8-9,14-19,22-23,25H,4-7,10-13,20-21,24H2,1-3H3,(H,39,43) |
| InChIKey | MNSQNKCDOCSVPJ-UHFFFAOYSA-N |
| XLogP | 6.71 |
| TPSA | 150.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 722.84 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|