C43H52N4O8S — CID 58244779
tert-butyl 13-cyclohexyl-3-methoxy-6-[4-[methyl-[2-[methyl-(2-nitrophenyl)sulfonylamino]ethyl]amino]butanoyl]-7H-indolo[2,1-a][2]benzazepine-10-carboxylate (PubChem CID 58244779) has the molecular formula C43H52N4O8S and a molecular weight of 784.98 g/mol. Its IUPAC name is tert-butyl 13-cyclohexyl-3-methoxy-6-[4-[methyl-[2-[methyl-(2-nitrophenyl)sulfonylamino]ethyl]amino]butanoyl]-7H-indolo[2,1-a][2]benzazepine-10-carboxylate.
| Compound Name | tert-butyl 13-cyclohexyl-3-methoxy-6-[4-[methyl-[2-[methyl-(2-nitrophenyl)sulfonylamino]ethyl]amino]butanoyl]-7H-indolo[2,1-a][2]benzazepine-10-carboxylate |
|---|---|
| PubChem CID | 58244779 |
| Molecular Formula | C43H52N4O8S |
| Molecular Weight | 784.98 g/mol |
| Exact Mass | 784.35 |
| IUPAC Name | tert-butyl 13-cyclohexyl-3-methoxy-6-[4-[methyl-[2-[methyl-(2-nitrophenyl)sulfonylamino]ethyl]amino]butanoyl]-7H-indolo[2,1-a][2]benzazepine-10-carboxylate |
| SMILES | COc1ccc2c(c1)C=C(C(=O)CCCN(C)CCN(C)S(=O)(=O)c1ccccc1[N+](=O)[O-])Cn1c-2c(C2CCCCC2)c2ccc(C(=O)OC(C)(C)C)cc21 |
| InChI | InChI=1S/C43H52N4O8S/c1-43(2,3)55-42(49)30-18-20-35-37(27-30)46-28-32(25-31-26-33(54-6)19-21-34(31)41(46)40(35)29-13-8-7-9-14-29)38(48)16-12-22-44(4)23-24-45(5)56(52,53)39-17-11-10-15-36(39)47(50)51/h10-11,15,17-21,25-27,29H,7-9,12-14,16,22-24,28H2,1-6H3 |
| InChIKey | SXUYAKXIQOBVOG-UHFFFAOYSA-N |
| XLogP | 8.23 |
| TPSA | 141.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 784.98 |
| LogP ≤ 5 | 8.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|