C38H45N3O8S — CID 58317810
methyl 3-cyclohexyl-1-methyl-2-[2-[8-[methyl-(2-nitrophenyl)sulfonylamino]-2-oxooctoxy]phenyl]indole-6-carboxylate (PubChem CID 58317810) has the molecular formula C38H45N3O8S and a molecular weight of 703.86 g/mol. Its IUPAC name is methyl 3-cyclohexyl-1-methyl-2-[2-[8-[methyl-(2-nitrophenyl)sulfonylamino]-2-oxooctoxy]phenyl]indole-6-carboxylate.
| Compound Name | methyl 3-cyclohexyl-1-methyl-2-[2-[8-[methyl-(2-nitrophenyl)sulfonylamino]-2-oxooctoxy]phenyl]indole-6-carboxylate |
|---|---|
| PubChem CID | 58317810 |
| Molecular Formula | C38H45N3O8S |
| Molecular Weight | 703.86 g/mol |
| Exact Mass | 703.29 |
| IUPAC Name | methyl 3-cyclohexyl-1-methyl-2-[2-[8-[methyl-(2-nitrophenyl)sulfonylamino]-2-oxooctoxy]phenyl]indole-6-carboxylate |
| SMILES | COC(=O)c1ccc2c(C3CCCCC3)c(-c3ccccc3OCC(=O)CCCCCCN(C)S(=O)(=O)c3ccccc3[N+](=O)[O-])n(C)c2c1 |
| InChI | InChI=1S/C38H45N3O8S/c1-39(50(46,47)35-21-13-11-19-32(35)41(44)45)24-14-5-4-9-17-29(42)26-49-34-20-12-10-18-31(34)37-36(27-15-7-6-8-16-27)30-23-22-28(38(43)48-3)25-33(30)40(37)2/h10-13,18-23,25,27H,4-9,14-17,24,26H2,1-3H3 |
| InChIKey | COLKEOQWWKTLJK-UHFFFAOYSA-N |
| XLogP | 7.81 |
| TPSA | 138.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 703.86 |
| LogP ≤ 5 | 7.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|