C39H47NO5Si — CID 58677124
methyl 2-[2-[[tert-butyl(dimethyl)silyl]oxymethyl]phenyl]-3-cyclohexyl-1-(3-oxo-3-phenylmethoxyprop-1-en-2-yl)indole-6-carboxylate (PubChem CID 58677124) has the molecular formula C39H47NO5Si and a molecular weight of 637.89 g/mol. Its IUPAC name is methyl 2-[2-[[tert-butyl(dimethyl)silyl]oxymethyl]phenyl]-3-cyclohexyl-1-(3-oxo-3-phenylmethoxyprop-1-en-2-yl)indole-6-carboxylate.
| Compound Name | methyl 2-[2-[[tert-butyl(dimethyl)silyl]oxymethyl]phenyl]-3-cyclohexyl-1-(3-oxo-3-phenylmethoxyprop-1-en-2-yl)indole-6-carboxylate |
|---|---|
| PubChem CID | 58677124 |
| Molecular Formula | C39H47NO5Si |
| Molecular Weight | 637.89 g/mol |
| Exact Mass | 637.32 |
| IUPAC Name | methyl 2-[2-[[tert-butyl(dimethyl)silyl]oxymethyl]phenyl]-3-cyclohexyl-1-(3-oxo-3-phenylmethoxyprop-1-en-2-yl)indole-6-carboxylate |
| SMILES | C=C(C(=O)OCc1ccccc1)n1c(-c2ccccc2CO[Si](C)(C)C(C)(C)C)c(C2CCCCC2)c2ccc(C(=O)OC)cc21 |
| InChI | InChI=1S/C39H47NO5Si/c1-27(37(41)44-25-28-16-10-8-11-17-28)40-34-24-30(38(42)43-5)22-23-33(34)35(29-18-12-9-13-19-29)36(40)32-21-15-14-20-31(32)26-45-46(6,7)39(2,3)4/h8,10-11,14-17,20-24,29H,1,9,12-13,18-19,25-26H2,2-7H3 |
| InChIKey | XCDSLDNEQVWKKH-UHFFFAOYSA-N |
| XLogP | 9.88 |
| TPSA | 66.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.89 |
| LogP ≤ 5 | 9.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|