C26H25BrN2O4 — CID 23152709
methyl 2-bromo-3-cyclohexyl-1-[2-(1,3-dioxoisoindol-2-yl)ethyl]indole-6-carboxylate (PubChem CID 23152709) has the molecular formula C26H25BrN2O4 and a molecular weight of 509.40 g/mol. Its IUPAC name is methyl 2-bromo-3-cyclohexyl-1-[2-(1,3-dioxoisoindol-2-yl)ethyl]indole-6-carboxylate.
| Compound Name | methyl 2-bromo-3-cyclohexyl-1-[2-(1,3-dioxoisoindol-2-yl)ethyl]indole-6-carboxylate |
|---|---|
| PubChem CID | 23152709 |
| Molecular Formula | C26H25BrN2O4 |
| Molecular Weight | 509.40 g/mol |
| Exact Mass | 508.10 |
| IUPAC Name | methyl 2-bromo-3-cyclohexyl-1-[2-(1,3-dioxoisoindol-2-yl)ethyl]indole-6-carboxylate |
| SMILES | COC(=O)c1ccc2c(C3CCCCC3)c(Br)n(CCN3C(=O)c4ccccc4C3=O)c2c1 |
| InChI | InChI=1S/C26H25BrN2O4/c1-33-26(32)17-11-12-20-21(15-17)28(23(27)22(20)16-7-3-2-4-8-16)13-14-29-24(30)18-9-5-6-10-19(18)25(29)31/h5-6,9-12,15-16H,2-4,7-8,13-14H2,1H3 |
| InChIKey | NXEKDYWPXWWRDD-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 68.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.40 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|