C22H30BNO6 — CID 59664971
[3-cyclohexyl-6-methoxycarbonyl-1-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]indol-2-yl]boronic acid (PubChem CID 59664971) has the molecular formula C22H30BNO6 and a molecular weight of 415.30 g/mol. Its IUPAC name is [3-cyclohexyl-6-methoxycarbonyl-1-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]indol-2-yl]boronic acid.
| Compound Name | [3-cyclohexyl-6-methoxycarbonyl-1-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]indol-2-yl]boronic acid |
|---|---|
| PubChem CID | 59664971 |
| Molecular Formula | C22H30BNO6 |
| Molecular Weight | 415.30 g/mol |
| Exact Mass | 415.22 |
| IUPAC Name | [3-cyclohexyl-6-methoxycarbonyl-1-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]indol-2-yl]boronic acid |
| SMILES | COC(=O)c1ccc2c(C3CCCCC3)c(B(O)O)n(CC(=O)OC(C)(C)C)c2c1 |
| InChI | InChI=1S/C22H30BNO6/c1-22(2,3)30-18(25)13-24-17-12-15(21(26)29-4)10-11-16(17)19(20(24)23(27)28)14-8-6-5-7-9-14/h10-12,14,27-28H,5-9,13H2,1-4H3 |
| InChIKey | WOAXJUCFQKERNE-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.30 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|