C21H28LiNO2 — CID 10019730
lithium tert-butyl 3-cyclohexyl-1-methylisoquinolin-1-ide-2-carboxylate (PubChem CID 10019730) has the molecular formula C21H28LiNO2 and a molecular weight of 333.40 g/mol. Its IUPAC name is lithium tert-butyl 3-cyclohexyl-1-methylisoquinolin-1-ide-2-carboxylate.
| Compound Name | lithium tert-butyl 3-cyclohexyl-1-methylisoquinolin-1-ide-2-carboxylate |
|---|---|
| PubChem CID | 10019730 |
| Molecular Formula | C21H28LiNO2 |
| Molecular Weight | 333.40 g/mol |
| Exact Mass | 333.23 |
| IUPAC Name | lithium tert-butyl 3-cyclohexyl-1-methylisoquinolin-1-ide-2-carboxylate |
| SMILES | C[C-]1c2ccccc2C=C(C2CCCCC2)N1C(=O)OC(C)(C)C.[Li+] |
| InChI | InChI=1S/C21H28NO2.Li/c1-15-18-13-9-8-12-17(18)14-19(16-10-6-5-7-11-16)22(15)20(23)24-21(2,3)4;/h8-9,12-14,16H,5-7,10-11H2,1-4H3;/q-1;+1 |
| InChIKey | CMAGHLTWRUFDAS-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.40 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|