C21H25NO3 — CID 174881226
tert-butyl 3-(naphthalene-2-carbonyl)piperidine-1-carboxylate (PubChem CID 174881226) has the molecular formula C21H25NO3 and a molecular weight of 339.44 g/mol. Its IUPAC name is tert-butyl 3-(naphthalene-2-carbonyl)piperidine-1-carboxylate.
| Compound Name | tert-butyl 3-(naphthalene-2-carbonyl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 174881226 |
| Molecular Formula | C21H25NO3 |
| Molecular Weight | 339.44 g/mol |
| Exact Mass | 339.18 |
| IUPAC Name | tert-butyl 3-(naphthalene-2-carbonyl)piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCC(C(=O)c2ccc3ccccc3c2)C1 |
| InChI | InChI=1S/C21H25NO3/c1-21(2,3)25-20(24)22-12-6-9-18(14-22)19(23)17-11-10-15-7-4-5-8-16(15)13-17/h4-5,7-8,10-11,13,18H,6,9,12,14H2,1-3H3 |
| InChIKey | HHHNEKGFKOTMQU-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.44 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |