C22H27NO4 — CID 121473838
tert-butyl 3-[4-(hydroxymethyl)naphthalene-2-carbonyl]piperidine-1-carboxylate (PubChem CID 121473838) has the molecular formula C22H27NO4 and a molecular weight of 369.46 g/mol. Its IUPAC name is tert-butyl 3-[4-(hydroxymethyl)naphthalene-2-carbonyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 3-[4-(hydroxymethyl)naphthalene-2-carbonyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 121473838 |
| Molecular Formula | C22H27NO4 |
| Molecular Weight | 369.46 g/mol |
| Exact Mass | 369.19 |
| IUPAC Name | tert-butyl 3-[4-(hydroxymethyl)naphthalene-2-carbonyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCC(C(=O)c2cc(CO)c3ccccc3c2)C1 |
| InChI | InChI=1S/C22H27NO4/c1-22(2,3)27-21(26)23-10-6-8-16(13-23)20(25)17-11-15-7-4-5-9-19(15)18(12-17)14-24/h4-5,7,9,11-12,16,24H,6,8,10,13-14H2,1-3H3 |
| InChIKey | QFXQRCCYUOCQBG-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.46 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |