C22H31N3O3 — CID 71632873
tert-butyl 3-[(2-cyanophenyl)methyl-propan-2-ylcarbamoyl]piperidine-1-carboxylate (PubChem CID 71632873) has the molecular formula C22H31N3O3 and a molecular weight of 385.51 g/mol. Its IUPAC name is tert-butyl 3-[(2-cyanophenyl)methyl-propan-2-ylcarbamoyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 3-[(2-cyanophenyl)methyl-propan-2-ylcarbamoyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 71632873 |
| Molecular Formula | C22H31N3O3 |
| Molecular Weight | 385.51 g/mol |
| Exact Mass | 385.24 |
| IUPAC Name | tert-butyl 3-[(2-cyanophenyl)methyl-propan-2-ylcarbamoyl]piperidine-1-carboxylate |
| SMILES | CC(C)N(Cc1ccccc1C#N)C(=O)C1CCCN(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C22H31N3O3/c1-16(2)25(15-18-10-7-6-9-17(18)13-23)20(26)19-11-8-12-24(14-19)21(27)28-22(3,4)5/h6-7,9-10,16,19H,8,11-12,14-15H2,1-5H3 |
| InChIKey | NXCBWXFNZCJKBO-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 73.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.51 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |