C22H34N2O3 — CID 156710383
tert-butyl (3R)-3-[methyl-[(4-propan-2-ylphenyl)methyl]carbamoyl]piperidine-1-carboxylate (PubChem CID 156710383) has the molecular formula C22H34N2O3 and a molecular weight of 374.53 g/mol. Its IUPAC name is tert-butyl (3R)-3-[methyl-[(4-propan-2-ylphenyl)methyl]carbamoyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl (3R)-3-[methyl-[(4-propan-2-ylphenyl)methyl]carbamoyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 156710383 |
| Molecular Formula | C22H34N2O3 |
| Molecular Weight | 374.53 g/mol |
| Exact Mass | 374.26 |
| IUPAC Name | tert-butyl (3R)-3-[methyl-[(4-propan-2-ylphenyl)methyl]carbamoyl]piperidine-1-carboxylate |
| SMILES | CC(C)c1ccc(CN(C)C(=O)[C@@H]2CCCN(C(=O)OC(C)(C)C)C2)cc1 |
| InChI | InChI=1S/C22H34N2O3/c1-16(2)18-11-9-17(10-12-18)14-23(6)20(25)19-8-7-13-24(15-19)21(26)27-22(3,4)5/h9-12,16,19H,7-8,13-15H2,1-6H3/t19-/m1/s1 |
| InChIKey | LKRRKFABBBULRD-LJQANCHMSA-N |
| XLogP | 4.42 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.53 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |