C20H28F2N2O4 — CID 134059870
tert-butyl 4-[[4-(difluoromethoxy)phenyl]methyl-methylcarbamoyl]piperidine-1-carboxylate (PubChem CID 134059870) has the molecular formula C20H28F2N2O4 and a molecular weight of 398.45 g/mol. Its IUPAC name is tert-butyl 4-[[4-(difluoromethoxy)phenyl]methyl-methylcarbamoyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[[4-(difluoromethoxy)phenyl]methyl-methylcarbamoyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 134059870 |
| Molecular Formula | C20H28F2N2O4 |
| Molecular Weight | 398.45 g/mol |
| Exact Mass | 398.20 |
| IUPAC Name | tert-butyl 4-[[4-(difluoromethoxy)phenyl]methyl-methylcarbamoyl]piperidine-1-carboxylate |
| SMILES | CN(Cc1ccc(OC(F)F)cc1)C(=O)C1CCN(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C20H28F2N2O4/c1-20(2,3)28-19(26)24-11-9-15(10-12-24)17(25)23(4)13-14-5-7-16(8-6-14)27-18(21)22/h5-8,15,18H,9-13H2,1-4H3 |
| InChIKey | COWYERGPCDQLGL-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.45 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |