C19H25F2NO4 — CID 58578286
tert-butyl 4-[2-[4-(difluoromethoxy)phenyl]acetyl]piperidine-1-carboxylate (PubChem CID 58578286) has the molecular formula C19H25F2NO4 and a molecular weight of 369.41 g/mol. Its IUPAC name is tert-butyl 4-[2-[4-(difluoromethoxy)phenyl]acetyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[2-[4-(difluoromethoxy)phenyl]acetyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 58578286 |
| Molecular Formula | C19H25F2NO4 |
| Molecular Weight | 369.41 g/mol |
| Exact Mass | 369.18 |
| IUPAC Name | tert-butyl 4-[2-[4-(difluoromethoxy)phenyl]acetyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(C(=O)Cc2ccc(OC(F)F)cc2)CC1 |
| InChI | InChI=1S/C19H25F2NO4/c1-19(2,3)26-18(24)22-10-8-14(9-11-22)16(23)12-13-4-6-15(7-5-13)25-17(20)21/h4-7,14,17H,8-12H2,1-3H3 |
| InChIKey | DZKOUQQOFNYBSQ-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.41 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |