C16H20F2N2O4 — CID 131741582
tert-butyl 3-[C-[4-(difluoromethoxy)phenyl]-N-hydroxycarbonimidoyl]azetidine-1-carboxylate (PubChem CID 131741582) has the molecular formula C16H20F2N2O4 and a molecular weight of 342.34 g/mol. Its IUPAC name is tert-butyl 3-[C-[4-(difluoromethoxy)phenyl]-N-hydroxycarbonimidoyl]azetidine-1-carboxylate.
| Compound Name | tert-butyl 3-[C-[4-(difluoromethoxy)phenyl]-N-hydroxycarbonimidoyl]azetidine-1-carboxylate |
|---|---|
| PubChem CID | 131741582 |
| Molecular Formula | C16H20F2N2O4 |
| Molecular Weight | 342.34 g/mol |
| Exact Mass | 342.14 |
| IUPAC Name | tert-butyl 3-[C-[4-(difluoromethoxy)phenyl]-N-hydroxycarbonimidoyl]azetidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC(C(=NO)c2ccc(OC(F)F)cc2)C1 |
| InChI | InChI=1S/C16H20F2N2O4/c1-16(2,3)24-15(21)20-8-11(9-20)13(19-22)10-4-6-12(7-5-10)23-14(17)18/h4-7,11,14,22H,8-9H2,1-3H3 |
| InChIKey | PEKUKOARXQJGOD-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 71.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.34 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|